CAS 42403-25-8 appears in our catalog under these names: Pyrrolidine-2,2,5,5-d4, 98 atom % D, min 98% Chemical Purity, Pyrrolidine-2,2,5,5-d4, >95% (GC). Offered by: CDN, TRC. Available pack sizes: 0,5g, 0,25g, 10mg, 50mg, 5mg.
2,2,5,5-tetradeuteriopyrrolidine (CAS 42403-25-8) is a chemical compound with the molecular formula C4H9N and a molecular weight of 75.15 g/mol. IUPAC name: 2,2,5,5-tetradeuteriopyrrolidine. InChIKey: RWRDLPDLKQPQOW-KHORGVISSA-N.
| Molecular formula | C4H9N |
|---|---|
| Molecular weight | 75.15 g/mol |
| IUPAC name | 2,2,5,5-tetradeuteriopyrrolidine |
| InChIKey | RWRDLPDLKQPQOW-KHORGVISSA-N |
| SMILES | [2H]C1(CCC(N1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)