CAS 212688-53-4 appears in our catalog under these names: Fmoc-L-Dap-OH*HCl, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-aminopropanoic acid hydrochloride, ≥95%, ≥95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 5g, 25g, 100g.
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride (CAS 212688-53-4) is a chemical compound with the molecular formula C18H19ClN2O4 and a molecular weight of 362.8 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride. InChIKey: GJIUYXQXIOYBMD-NTISSMGPSA-N.
| Molecular formula | C18H19ClN2O4 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride |
| InChIKey | GJIUYXQXIOYBMD-NTISSMGPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O.Cl |
Computed by PubChem (NCBI)