CAS 487027-89-4 appears in our catalog under these names: Fmoc-d-dap-oh hydrochloride, 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-aminopropanoic acid hydrochloride, 95+%, Fmoc–d–dap–oh hydrochloride, Fmoc-D-Dap-OH*HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech. Available pack sizes: 5g, 250mg, 1g, 25g.
(2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride (CAS 487027-89-4) is a chemical compound with the molecular formula C18H19ClN2O4 and a molecular weight of 362.8 g/mol. IUPAC name: (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride. InChIKey: GJIUYXQXIOYBMD-PKLMIRHRSA-N.
| Molecular formula | C18H19ClN2O4 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;hydrochloride |
| InChIKey | GJIUYXQXIOYBMD-PKLMIRHRSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CN)C(=O)O.Cl |
Computed by PubChem (NCBI)