Products 2128719-74-2
CAS 2128719-74-2 appears in our catalog under these names: Medetomidine Impurity 7, Dexmedetomidine Impurity 14, Medetomidine Impurity 36. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[1-(2,3-dimethylphenyl)ethyl]-1-hydroxyimidazole (CAS 2128719-74-2) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: 4-[1-(2,3-dimethylphenyl)ethyl]-1-hydroxyimidazole. InChIKey: KEQGLINVWQFDJN-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 4-[1-(2,3-dimethylphenyl)ethyl]-1-hydroxyimidazole |
| InChIKey | KEQGLINVWQFDJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN(C=N2)O)C |
Computed by PubChem (NCBI)