Products 2130879-83-1
CAS 2130879-83-1 is the registry number for AB–CHMINACA metabolite M1A. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(4-hydroxycyclohexyl)methyl]indazole-3-carboxamide (CAS 2130879-83-1) is a chemical compound with the molecular formula C20H28N4O3 and a molecular weight of 372.5 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(4-hydroxycyclohexyl)methyl]indazole-3-carboxamide. InChIKey: GAXQKKYBSIFRJX-KVULBXGLSA-N.
| Molecular formula | C20H28N4O3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(4-hydroxycyclohexyl)methyl]indazole-3-carboxamide |
| InChIKey | GAXQKKYBSIFRJX-KVULBXGLSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCC(CC3)O |
Computed by PubChem (NCBI)
Synonyms:
AB-CHMINACA metabolite M1A