Products 2131173-54-9
CAS 2131173-54-9 is the registry number for AB–CHMINACA metabolite M1B. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(3-hydroxycyclohexyl)methyl]indazole-3-carboxamide (CAS 2131173-54-9) is a chemical compound with the molecular formula C20H28N4O3 and a molecular weight of 372.5 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(3-hydroxycyclohexyl)methyl]indazole-3-carboxamide. InChIKey: JPYMZGZGKXHPPL-KVULBXGLSA-N.
| Molecular formula | C20H28N4O3 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(3-hydroxycyclohexyl)methyl]indazole-3-carboxamide |
| InChIKey | JPYMZGZGKXHPPL-KVULBXGLSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCCC(C3)O |
Computed by PubChem (NCBI)
Synonyms:
AB-CHMINACA metabolite M1B