CAS 2131118-50-6 is the registry number for H-L-MeAla(4-Thz)-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g.
(2S)-2-(methylamino)-3-(1,3-thiazol-4-yl)propanoic acid (CAS 2131118-50-6) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: (2S)-2-(methylamino)-3-(1,3-thiazol-4-yl)propanoic acid. InChIKey: SJJJQDIGKIMGTG-LURJTMIESA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-(1,3-thiazol-4-yl)propanoic acid |
| InChIKey | SJJJQDIGKIMGTG-LURJTMIESA-N |
| SMILES | CN[C@@H](CC1=CSC=N1)C(=O)O |
Computed by PubChem (NCBI)