Products 2132944-68-2

CAS 2132944-68-2 is the registry number for 2-Chloro-3-ethoxyisonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-3-ethoxypyridine-4-carboxylic acid (CAS 2132944-68-2) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 2-chloro-3-ethoxypyridine-4-carboxylic acid. InChIKey: OXRMBXMXBJTJHU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO3
Molecular weight201.61 g/mol
IUPAC name2-chloro-3-ethoxypyridine-4-carboxylic acid
InChIKeyOXRMBXMXBJTJHU-UHFFFAOYSA-N
SMILESCCOC1=C(C=CN=C1Cl)C(=O)O

Computed by PubChem (NCBI)