Products 213313-43-0
CAS 213313-43-0 is the registry number for Methyl 3,5-bis-O-(phenylmethyl)-D-arabinofuranoside, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
(3S,4S,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol (CAS 213313-43-0) is a chemical compound with the molecular formula C20H24O5 and a molecular weight of 344.4 g/mol. IUPAC name: (3S,4S,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol. InChIKey: SOWIHMANTOCUNZ-BMHONFFRSA-N.
| Molecular formula | C20H24O5 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (3S,4S,5R)-2-methoxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol |
| InChIKey | SOWIHMANTOCUNZ-BMHONFFRSA-N |
| SMILES | COC1[C@H]([C@@H]([C@H](O1)COCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)