CAS 213338-96-6 is the registry number for N6-((2,5-Dimethoxyphenyl)methyl)-N6-methyl-2,4,6-quinazolinetriamine. Offered by: TRC. Available pack sizes: 100mg.
6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-methylquinazoline-2,4,6-triamine (CAS 213338-96-6) is a chemical compound with the molecular formula C18H21N5O2 and a molecular weight of 339.4 g/mol. IUPAC name: 6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-methylquinazoline-2,4,6-triamine. InChIKey: YBJANOUTWRTBDK-UHFFFAOYSA-N.
| Molecular formula | C18H21N5O2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 6-N-[(2,5-dimethoxyphenyl)methyl]-6-N-methylquinazoline-2,4,6-triamine |
| InChIKey | YBJANOUTWRTBDK-UHFFFAOYSA-N |
| SMILES | CN(CC1=C(C=CC(=C1)OC)OC)C2=CC3=C(C=C2)N=C(N=C3N)N |
Computed by PubChem (NCBI)