CAS 2133479-34-0 appears in our catalog under these names: (1S,2R)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate hydrochloride, 98%, (1S,2R)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate hydrochloride, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Trans-ethyl (1S,2R)-1-amino-2-ethenylcyclopropane-1-carboxylate;hydrochloride (CAS 2133479-34-0) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: trans-ethyl (1S,2R)-1-amino-2-ethenylcyclopropane-1-carboxylate;hydrochloride. InChIKey: RSBFMCGEQFBZBE-QMGYSKNISA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | trans-ethyl (1S,2R)-1-amino-2-ethenylcyclopropane-1-carboxylate;hydrochloride |
| InChIKey | RSBFMCGEQFBZBE-QMGYSKNISA-N |
| SMILES | CCOC(=O)[C@@]1(C[C@@H]1C=C)N.Cl |
Computed by PubChem (NCBI)