CAS 213381-43-2 appears in our catalog under these names: 7-BROMO-2-METHYL-1-INDANONE, 95%, 7-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 7-Bromo-2-methyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-2-methyl-2,3-dihydroinden-1-one (CAS 213381-43-2) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-2-methyl-2,3-dihydroinden-1-one. InChIKey: QHKFBWKOHWQEFW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | QHKFBWKOHWQEFW-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C(=CC=C2)Br |
Computed by PubChem (NCBI)