Products 213390-67-1
CAS 213390-67-1 is the registry number for 2-{[(tert-butoxy)carbonyl]amino}thiophene-3-carboxylic acid, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid (CAS 213390-67-1) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid. InChIKey: WSLMBLWUZZCDNI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid |
| InChIKey | WSLMBLWUZZCDNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CS1)C(=O)O |
Computed by PubChem (NCBI)