CAS 213400-12-5 appears in our catalog under these names: rel-(1R,2R)-2-(3,4-Dichlorobenzoyl)cyclopropanecarboxylic acid, 97%, Cyclopropanecarboxylic acid, 2-(3,4-dichlorobenzoyl)-, (1R,2R)-rel-, 97%, 97%, tran-(1S,2S)-2-(3,4-Dichlorobenzoyl)cyclopropane-1-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5mg, 10mg.
Trans-(1R,2R)-2-(3,4-dichlorobenzoyl)cyclopropane-1-carboxylic acid (CAS 213400-12-5) is a chemical compound with the molecular formula C11H8Cl2O3 and a molecular weight of 259.08 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-dichlorobenzoyl)cyclopropane-1-carboxylic acid. InChIKey: ZBRKMOHDGFGXLN-RNFRBKRXSA-N.
| Molecular formula | C11H8Cl2O3 |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-dichlorobenzoyl)cyclopropane-1-carboxylic acid |
| InChIKey | ZBRKMOHDGFGXLN-RNFRBKRXSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)