Products 91183-47-0
CAS 91183-47-0 is the registry number for Ethyl 5,7-dichlorobenzofuran-2-carboxylate, 95+%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g.
Ethyl 5,7-dichloro-1-benzofuran-2-carboxylate (CAS 91183-47-0) is a chemical compound with the molecular formula C11H8Cl2O3 and a molecular weight of 259.08 g/mol. IUPAC name: ethyl 5,7-dichloro-1-benzofuran-2-carboxylate. InChIKey: LEUQFLHZWSQDTC-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2O3 |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | ethyl 5,7-dichloro-1-benzofuran-2-carboxylate |
| InChIKey | LEUQFLHZWSQDTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2O1)Cl)Cl |
Computed by PubChem (NCBI)