CAS 213455-13-1 is the registry number for 5-((4-Hydroxybenzo[b]thiophen-7-yl)methyl)thiazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-[(4-hydroxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione (CAS 213455-13-1) is a chemical compound with the molecular formula C12H9NO3S2 and a molecular weight of 279.3 g/mol. IUPAC name: 5-[(4-hydroxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: BKFYILSMFALMFP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 5-[(4-hydroxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | BKFYILSMFALMFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CSC2=C1CC3C(=O)NC(=O)S3)O |
Computed by PubChem (NCBI)