CAS 926211-05-4 appears in our catalog under these names: 2-({4-methyl-5,12-dithia-3-azatricyclo(7.3.0.0,2,6)dodeca-1,3,6,8,10-pentaen-8-yl}oxy)acetic acid, 95%, 2-({4-Methyl-5,12-dithia-3-azatricyclo(7.3.0.0,2,6)dodeca-1,3,6,8,10-pentaen-8-yl}oxy)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetic acid (CAS 926211-05-4) is a chemical compound with the molecular formula C12H9NO3S2 and a molecular weight of 279.3 g/mol. IUPAC name: 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetic acid. InChIKey: KDWIITILHAOQET-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3S2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyacetic acid |
| InChIKey | KDWIITILHAOQET-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C3=C2SC=C3)OCC(=O)O |
Computed by PubChem (NCBI)