Products 2134633-62-6
CAS 2134633-62-6 appears in our catalog under these names: 2-Amino-4-bromo-3-fluoro-5-(trifluoromethyl)benzoic acid, 98%, 2-Amino-4-bromo-3-fluoro-5-(trifluoromethyl)benzoic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
2-amino-4-bromo-3-fluoro-5-(trifluoromethyl)benzoic acid (CAS 2134633-62-6) is a chemical compound with the molecular formula C8H4BrF4NO2 and a molecular weight of 302.02 g/mol. IUPAC name: 2-amino-4-bromo-3-fluoro-5-(trifluoromethyl)benzoic acid. InChIKey: PKPFCLGECKRINR-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF4NO2 |
|---|---|
| Molecular weight | 302.02 g/mol |
| IUPAC name | 2-amino-4-bromo-3-fluoro-5-(trifluoromethyl)benzoic acid |
| InChIKey | PKPFCLGECKRINR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1C(F)(F)F)Br)F)N)C(=O)O |
Computed by PubChem (NCBI)