CAS 254895-87-9 is the registry number for 6-Amino-7-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-amine (CAS 254895-87-9) is a chemical compound with the molecular formula C8H4BrF4NO2 and a molecular weight of 302.02 g/mol. IUPAC name: 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-amine. InChIKey: NYIKJZPXJFXSLT-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF4NO2 |
|---|---|
| Molecular weight | 302.02 g/mol |
| IUPAC name | 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-amine |
| InChIKey | NYIKJZPXJFXSLT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(C(O2)(F)F)(F)F)Br)N |
Computed by PubChem (NCBI)