Products 2134647-39-3
CAS 2134647-39-3 appears in our catalog under these names: 2-(tert-Butyl) 5-methyl 7-bromoisoindoline-2,5-dicarboxylate, 98%, 98%, 2-(tert-Butyl) 5-methyl 7-bromoisoindoline-2,5-dicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-O-tert-butyl 5-O-methyl 7-bromo-1,3-dihydroisoindole-2,5-dicarboxylate (CAS 2134647-39-3) is a chemical compound with the molecular formula C15H18BrNO4 and a molecular weight of 356.21 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 7-bromo-1,3-dihydroisoindole-2,5-dicarboxylate. InChIKey: NWNOECAOUDIHDU-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO4 |
|---|---|
| Molecular weight | 356.21 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl 7-bromo-1,3-dihydroisoindole-2,5-dicarboxylate |
| InChIKey | NWNOECAOUDIHDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC(=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)