CAS 1788044-06-3 appears in our catalog under these names: 1-tert-Butyl 6-methyl 5-bromo-2,3-dihydroindole-1,6-dicarboxylate, 95%, 1-tert-Butyl 6-methyl 5-bromoindoline-1,6-dicarboxylate, 97%, 1-tert-Butyl 6-methyl 5-bromoindoline-1，6-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 250mg, 500mg.
1-O-tert-butyl 6-O-methyl 5-bromo-2,3-dihydroindole-1,6-dicarboxylate (CAS 1788044-06-3) is a chemical compound with the molecular formula C15H18BrNO4 and a molecular weight of 356.21 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 5-bromo-2,3-dihydroindole-1,6-dicarboxylate. InChIKey: ALMIPSFOUKYMFF-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO4 |
|---|---|
| Molecular weight | 356.21 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 5-bromo-2,3-dihydroindole-1,6-dicarboxylate |
| InChIKey | ALMIPSFOUKYMFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(=C(C=C21)C(=O)OC)Br |
Computed by PubChem (NCBI)