Products 348640-13-1
CAS 348640-13-1 is the registry number for tert-Butyl 3-bromo-5,6-dimethoxy-1H-indole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-5,6-dimethoxyindole-1-carboxylate (CAS 348640-13-1) is a chemical compound with the molecular formula C15H18BrNO4 and a molecular weight of 356.21 g/mol. IUPAC name: tert-butyl 3-bromo-5,6-dimethoxyindole-1-carboxylate. InChIKey: IPYTZUXGOBSNTP-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO4 |
|---|---|
| Molecular weight | 356.21 g/mol |
| IUPAC name | tert-butyl 3-bromo-5,6-dimethoxyindole-1-carboxylate |
| InChIKey | IPYTZUXGOBSNTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC(=C(C=C21)OC)OC)Br |
Computed by PubChem (NCBI)