Products 2135331-49-4
CAS 2135331-49-4 appears in our catalog under these names: 1–(5–Cyanopyridin–2–yl)cyclopropane–1–carboxylic acid, 1-(5-Cyanopyridin-2-yl)cyclopropane-1-carboxylic acid, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 25mg, 1g, 250mg.
1-(5-cyano-2-pyridinyl)cyclopropane-1-carboxylic acid (CAS 2135331-49-4) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 1-(5-cyano-2-pyridinyl)cyclopropane-1-carboxylic acid. InChIKey: JGTJBYSKUOQGKU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-(5-cyano-2-pyridinyl)cyclopropane-1-carboxylic acid |
| InChIKey | JGTJBYSKUOQGKU-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=NC=C(C=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)