CAS 2135332-55-5 appears in our catalog under these names: Pyridin-2-ylmethanesulfonic acid hydrochloride, 95%, PYRIDIN-2-YLMETHANESULFONIC ACID HCL, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Pyridin-2-ylmethanesulfonic acid;hydrochloride (CAS 2135332-55-5) is a chemical compound with the molecular formula C6H8ClNO3S and a molecular weight of 209.65 g/mol. IUPAC name: pyridin-2-ylmethanesulfonic acid;hydrochloride. InChIKey: ZVTAJMFYZISBNI-UHFFFAOYSA-N.
| Molecular formula | C6H8ClNO3S |
|---|---|
| Molecular weight | 209.65 g/mol |
| IUPAC name | pyridin-2-ylmethanesulfonic acid;hydrochloride |
| InChIKey | ZVTAJMFYZISBNI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CS(=O)(=O)O.Cl |
Computed by PubChem (NCBI)