CAS 850188-43-1 is the registry number for 2-Chloro-N-(2,3-dihydro-1,1-dioxido-3-thienyl)acetamide, 99.78%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 5 mg.
2-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide (CAS 850188-43-1) is a chemical compound with the molecular formula C6H8ClNO3S and a molecular weight of 209.65 g/mol. IUPAC name: 2-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide. InChIKey: PMGOLXUFJBBKQZ-UHFFFAOYSA-N.
| Molecular formula | C6H8ClNO3S |
|---|---|
| Molecular weight | 209.65 g/mol |
| IUPAC name | 2-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetamide |
| InChIKey | PMGOLXUFJBBKQZ-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC(=O)CCl |
Computed by PubChem (NCBI)