CAS 213552-47-7 is the registry number for Drim-7-ene-11,12-diol acetonide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(7aS,11aS,11bR)-3,3,8,8,11a-pentamethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine (CAS 213552-47-7) is a chemical compound with the molecular formula C18H30O2 and a molecular weight of 278.4 g/mol. IUPAC name: (7aS,11aS,11bR)-3,3,8,8,11a-pentamethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine. InChIKey: GTTSZASHZJQOCB-RLFYNMQTSA-N.
| Molecular formula | C18H30O2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | (7aS,11aS,11bR)-3,3,8,8,11a-pentamethyl-1,5,7,7a,9,10,11,11b-octahydrobenzo[g][2,4]benzodioxepine |
| InChIKey | GTTSZASHZJQOCB-RLFYNMQTSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CC=C3[C@@H]2COC(OC3)(C)C)(C)C |
Computed by PubChem (NCBI)