CAS 2137029-01-5 is the registry number for (2R)-1-((2-Methyl-2H-1,2,3,4-tetrazol-5-yl)methyl)pyrrolidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R)-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 2137029-01-5) is a chemical compound with the molecular formula C8H14ClN5O2 and a molecular weight of 247.68 g/mol. IUPAC name: (2R)-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UKJOMBQJRVXQKN-FYZOBXCZSA-N.
| Molecular formula | C8H14ClN5O2 |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | (2R)-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UKJOMBQJRVXQKN-FYZOBXCZSA-N |
| SMILES | CN1N=C(N=N1)CN2CCC[C@@H]2C(=O)O.Cl |
Computed by PubChem (NCBI)