CAS 2173099-15-3 is the registry number for 6-(4-Aminopiperidin-1-yl)-4-hydroxy-1,3,5-triazin-2(1h)-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(4-aminopiperidin-1-yl)-1H-1,3,5-triazine-2,4-dione;hydrochloride (CAS 2173099-15-3) is a chemical compound with the molecular formula C8H14ClN5O2 and a molecular weight of 247.68 g/mol. IUPAC name: 6-(4-aminopiperidin-1-yl)-1H-1,3,5-triazine-2,4-dione;hydrochloride. InChIKey: NOKPHQZFSFKKCA-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN5O2 |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 6-(4-aminopiperidin-1-yl)-1H-1,3,5-triazine-2,4-dione;hydrochloride |
| InChIKey | NOKPHQZFSFKKCA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=NC(=O)NC(=O)N2.Cl |
Computed by PubChem (NCBI)