CAS 2137036-84-9 appears in our catalog under these names: H-L-Phe(4-N=NPh)-OH*HCl, Phenylalanine-4′-azobenzene HCl, 99.77%. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 100mg, 500mg, 1g, 50 mg, 10 mg, 25 mg, 100 mg.
(2S)-2-amino-3-(4-phenyldiazenylphenyl)propanoic acid;hydrochloride (CAS 2137036-84-9) is a chemical compound with the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. IUPAC name: (2S)-2-amino-3-(4-phenyldiazenylphenyl)propanoic acid;hydrochloride. InChIKey: LRSKKAMIJGFIDZ-UQKRIMTDSA-N.
| Molecular formula | C15H16ClN3O2 |
|---|---|
| Molecular weight | 305.76 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-phenyldiazenylphenyl)propanoic acid;hydrochloride |
| InChIKey | LRSKKAMIJGFIDZ-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)