Products 2137086-61-2
CAS 2137086-61-2 is the registry number for 1-((1R)-1-Chloroethyl)-3-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(1R)-1-chloroethyl]-3-nitrobenzene (CAS 2137086-61-2) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 1-[(1R)-1-chloroethyl]-3-nitrobenzene. InChIKey: QRWUNNJGVSGUAF-ZCFIWIBFSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 1-[(1R)-1-chloroethyl]-3-nitrobenzene |
| InChIKey | QRWUNNJGVSGUAF-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)