Products 2137142-24-4
CAS 2137142-24-4 is the registry number for (6S)-2,8,11-Triazatricyclo(8.4.0.0,2,6)tetradeca-1(14),10,12-triene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene (CAS 2137142-24-4) is a chemical compound with the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. IUPAC name: (6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene. InChIKey: WITHGVJHTLYJCI-VIFPVBQESA-N.
| Molecular formula | C11H15N3 |
|---|---|
| Molecular weight | 189.26 g/mol |
| IUPAC name | (6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene |
| InChIKey | WITHGVJHTLYJCI-VIFPVBQESA-N |
| SMILES | C1C[C@H]2CNCC3=C(N2C1)C=CC=N3 |
Computed by PubChem (NCBI)