CAS 2137433-63-5 is the registry number for rac-(1R,5R,6S)-6-Aminobicyclo(3.2.0)heptane-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,5S,6R)-6-aminobicyclo[3.2.0]heptane-3-carboxylic acid;hydrochloride (CAS 2137433-63-5) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1S,5S,6R)-6-aminobicyclo[3.2.0]heptane-3-carboxylic acid;hydrochloride. InChIKey: JPTFCOBLKSDRIJ-XCMKYYOMSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1S,5S,6R)-6-aminobicyclo[3.2.0]heptane-3-carboxylic acid;hydrochloride |
| InChIKey | JPTFCOBLKSDRIJ-XCMKYYOMSA-N |
| SMILES | C1[C@@H]2CC(C[C@@H]2[C@@H]1N)C(=O)O.Cl |
Computed by PubChem (NCBI)