Products 2137434-35-4
CAS 2137434-35-4 is the registry number for rac-(6R,7R)-7-Amino-2-methyl-1-(propan-2-yl)-2-azaspiro(3.4)octan-6-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6R,7R)-7-amino-2-methyl-3-propan-2-yl-2-azaspiro[3.4]octan-6-ol (CAS 2137434-35-4) is a chemical compound with the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. IUPAC name: (6R,7R)-7-amino-2-methyl-3-propan-2-yl-2-azaspiro[3.4]octan-6-ol. InChIKey: LKFUIYHIYQDVKG-NKVNRFPTSA-N.
| Molecular formula | C11H22N2O |
|---|---|
| Molecular weight | 198.31 g/mol |
| IUPAC name | (6R,7R)-7-amino-2-methyl-3-propan-2-yl-2-azaspiro[3.4]octan-6-ol |
| InChIKey | LKFUIYHIYQDVKG-NKVNRFPTSA-N |
| SMILES | CC(C)C1C2(C[C@H]([C@@H](C2)O)N)CN1C |
Computed by PubChem (NCBI)