CAS 2137567-74-7 is the registry number for rac-1-((1R,2S)-2-Aminocyclohexyl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(1S,2R)-2-aminocyclohexyl]triazole-4-carboxylic acid;hydrochloride (CAS 2137567-74-7) is a chemical compound with the molecular formula C9H15ClN4O2 and a molecular weight of 246.69 g/mol. IUPAC name: 1-[(1S,2R)-2-aminocyclohexyl]triazole-4-carboxylic acid;hydrochloride. InChIKey: JUNMWFUSQXPAKG-HNJRQZNRSA-N.
| Molecular formula | C9H15ClN4O2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 1-[(1S,2R)-2-aminocyclohexyl]triazole-4-carboxylic acid;hydrochloride |
| InChIKey | JUNMWFUSQXPAKG-HNJRQZNRSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)N2C=C(N=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)