CAS 2378503-63-8 is the registry number for rac-Methyl 1-{((1R,3R)-3-aminocyclobutyl)methyl}-1H-1,2,3-triazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylate;hydrochloride (CAS 2378503-63-8) is a chemical compound with the molecular formula C9H15ClN4O2 and a molecular weight of 246.69 g/mol. IUPAC name: methyl 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylate;hydrochloride. InChIKey: UJQMEZPQXHRMFC-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN4O2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | methyl 1-[(3-aminocyclobutyl)methyl]triazole-4-carboxylate;hydrochloride |
| InChIKey | UJQMEZPQXHRMFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(N=N1)CC2CC(C2)N.Cl |
Computed by PubChem (NCBI)