CAS 2137611-82-4 appears in our catalog under these names: N-(2-Aminoethyl)pyrazine-2-carboxamide dihydrochloride, 95%, N-(2-Aminoethyl)pyrazine-2-carboxamide dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g.
N-(2-aminoethyl)pyrazine-2-carboxamide;dihydrochloride (CAS 2137611-82-4) is a chemical compound with the molecular formula C7H12Cl2N4O and a molecular weight of 239.10 g/mol. IUPAC name: N-(2-aminoethyl)pyrazine-2-carboxamide;dihydrochloride. InChIKey: BAVSGYDLQGIKEJ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4O |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | N-(2-aminoethyl)pyrazine-2-carboxamide;dihydrochloride |
| InChIKey | BAVSGYDLQGIKEJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C(=O)NCCN.Cl.Cl |
Computed by PubChem (NCBI)