CAS 2648941-90-4 is the registry number for 2-Amino-5,6,7,8-tetrahydropyrido(3,4-d)pyrimidin-4(3H)-one dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-amino-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;dihydrochloride (CAS 2648941-90-4) is a chemical compound with the molecular formula C7H12Cl2N4O and a molecular weight of 239.10 g/mol. IUPAC name: 2-amino-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;dihydrochloride. InChIKey: RWHGHYYBHZTCKC-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N4O |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 2-amino-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one;dihydrochloride |
| InChIKey | RWHGHYYBHZTCKC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=O)NC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)