CAS 21377-09-3 appears in our catalog under these names: 1-Benzyl-1H-pyrazol-3-amine 98%, 1-Benzyl-1H-pyrazol-3-amine, 98%, 98%, 1-Benzyl-1 H -pyrazol-3-ylamine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
1-benzylpyrazol-3-amine (CAS 21377-09-3) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 1-benzylpyrazol-3-amine. InChIKey: VSUXHXCLAWFAJR-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1-benzylpyrazol-3-amine |
| InChIKey | VSUXHXCLAWFAJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=N2)N |
Computed by PubChem (NCBI)