CAS 2137762-21-9 is the registry number for Rel-(3aR,6aS)-4,4-difluorooctahydrocyclopenta(c)pyrrole hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride (CAS 2137762-21-9) is a chemical compound with the molecular formula C7H12ClF2N and a molecular weight of 183.63 g/mol. IUPAC name: (3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride. InChIKey: XGFLSKFCOYEEAH-IBTYICNHSA-N.
| Molecular formula | C7H12ClF2N |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (3aR,6aS)-4,4-difluoro-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;hydrochloride |
| InChIKey | XGFLSKFCOYEEAH-IBTYICNHSA-N |
| SMILES | C1CC([C@@H]2[C@H]1CNC2)(F)F.Cl |
Computed by PubChem (NCBI)