CAS 2137817-97-9 appears in our catalog under these names: rel-(2R,4R)-4-((tert-Butoxycarbonyl)amino)tetrahydro-2H-pyran-2-carboxylic acid, 97%, 97%, rel-(2R,4R)-4-(tert-Butoxycarbonylamino)tetrahydropyran-2-carboxylic acid, 97%, rac-(2R,4R)-4-{((tert-Butoxy)carbonyl)amino}oxane-2-carboxylic acid. Offered by: Chemat, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g, 0,5g, 50mg.
(2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid (CAS 2137817-97-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid. InChIKey: PCGLJGXKSGRHSC-HTQZYQBOSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid |
| InChIKey | PCGLJGXKSGRHSC-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCO[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)