CAS 2306245-87-2 appears in our catalog under these names: (2S,4R)-4-((tert-Butoxycarbonyl)amino)tetrahydro-2H-pyran-2-carboxylic acid, 98%, (2S,4R)-4-((tert-Butoxycarbonyl)amino)tetrahydro-2H-pyran-2-carboxylic acid, 97%, 97%, (2S,4R)-4-{[(tert-butoxy)carbonyl]amino}oxane-2-carboxylic acid, 9500%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid (CAS 2306245-87-2) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid. InChIKey: PCGLJGXKSGRHSC-SFYZADRCSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylic acid |
| InChIKey | PCGLJGXKSGRHSC-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCO[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)