CAS 2137836-44-1 is the registry number for rac-Methyl (1R,5S)-5-aminocyclohex-3-ene-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (1R,5S)-5-aminocyclohex-3-ene-1-carboxylate;hydrochloride (CAS 2137836-44-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl (1R,5S)-5-aminocyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: NCRKCWMIKUBESC-ZJLYAJKPSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | methyl (1R,5S)-5-aminocyclohex-3-ene-1-carboxylate;hydrochloride |
| InChIKey | NCRKCWMIKUBESC-ZJLYAJKPSA-N |
| SMILES | COC(=O)[C@@H]1CC=C[C@H](C1)N.Cl |
Computed by PubChem (NCBI)