Products 2137845-36-2
CAS 2137845-36-2 is the registry number for 3-Benzyl-4-chloro-1H-pyrrolo(2,3-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-benzyl-4-chloro-1H-pyrrolo[2,3-b]pyridine (CAS 2137845-36-2) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 3-benzyl-4-chloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: BZZADIJRDMGTNJ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 3-benzyl-4-chloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | BZZADIJRDMGTNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CNC3=NC=CC(=C23)Cl |
Computed by PubChem (NCBI)