Products 21379-33-9
CAS 21379-33-9 appears in our catalog under these names: 4,4,4-Trifluoro-3-(trifluoromethyl)butane-1,3-diol, 98%, 98%, 4,4,4-Trifluoro-3-(trifluoromethyl)butane-1,3-diol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol (CAS 21379-33-9) is a chemical compound with the molecular formula C5H6F6O2 and a molecular weight of 212.09 g/mol. IUPAC name: 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol. InChIKey: PYTQULGOMFBQNV-UHFFFAOYSA-N.
| Molecular formula | C5H6F6O2 |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol |
| InChIKey | PYTQULGOMFBQNV-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)