Products 21379-33-9
CAS 21379-33-9 is the registry number for 4,4,4-Trifluoro-3-(trifluoromethyl)butane-1,3-diol, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol (CAS 21379-33-9) is a chemical compound with the molecular formula C5H6F6O2 and a molecular weight of 212.09 g/mol. IUPAC name: 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol. InChIKey: PYTQULGOMFBQNV-UHFFFAOYSA-N.
| Molecular formula | C5H6F6O2 |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(trifluoromethyl)butane-1,3-diol |
| InChIKey | PYTQULGOMFBQNV-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)