Products 2137914-42-0

CAS 2137914-42-0 is the registry number for 4-Methylpyridine-3-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-methylpyridine-3-sulfonyl fluoride (CAS 2137914-42-0) is a chemical compound with the molecular formula C6H6FNO2S and a molecular weight of 175.18 g/mol. IUPAC name: 4-methylpyridine-3-sulfonyl fluoride. InChIKey: PBVMAZXFMUSURP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6FNO2S
Molecular weight175.18 g/mol
IUPAC name4-methylpyridine-3-sulfonyl fluoride
InChIKeyPBVMAZXFMUSURP-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1)S(=O)(=O)F

Computed by PubChem (NCBI)