CAS 2138-34-3 appears in our catalog under these names: 3-(Dimethylamino)-4'-bromopropiophenone, Aldi-6, 98%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 1g, 5g.
1-(4-bromophenyl)-3-(dimethylamino)propan-1-one (CAS 2138-34-3) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(dimethylamino)propan-1-one. InChIKey: RSRQDUSONVRSMB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-(dimethylamino)propan-1-one |
| InChIKey | RSRQDUSONVRSMB-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)