Products 2138015-24-2
CAS 2138015-24-2 is the registry number for rac-tert-Butyl 1-((1R,2S)-2-aminocyclohexyl)-1H-1,2,3-triazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate (CAS 2138015-24-2) is a chemical compound with the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. IUPAC name: tert-butyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate. InChIKey: KCTVAOHCDQOBEJ-GXSJLCMTSA-N.
| Molecular formula | C13H22N4O2 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | tert-butyl 1-[(1R,2S)-2-aminocyclohexyl]triazole-4-carboxylate |
| InChIKey | KCTVAOHCDQOBEJ-GXSJLCMTSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN(N=N1)[C@@H]2CCCC[C@@H]2N |
Computed by PubChem (NCBI)