CAS 2138062-05-0 is the registry number for 1-Bromo-2-(2,2,3,3-tetrafluorocyclobutyl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-2-(2,2,3,3-tetrafluorocyclobutyl)benzene (CAS 2138062-05-0) is a chemical compound with the molecular formula C10H7BrF4 and a molecular weight of 283.06 g/mol. IUPAC name: 1-bromo-2-(2,2,3,3-tetrafluorocyclobutyl)benzene. InChIKey: JBBYANQSUHUIHE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF4 |
|---|---|
| Molecular weight | 283.06 g/mol |
| IUPAC name | 1-bromo-2-(2,2,3,3-tetrafluorocyclobutyl)benzene |
| InChIKey | JBBYANQSUHUIHE-UHFFFAOYSA-N |
| SMILES | C1C(C(C1(F)F)(F)F)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)