CAS 885267-02-7 is the registry number for 1-Bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene (CAS 885267-02-7) is a chemical compound with the molecular formula C10H7BrF4 and a molecular weight of 283.06 g/mol. IUPAC name: 1-bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene. InChIKey: KDNLQJIMDWXOHJ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF4 |
|---|---|
| Molecular weight | 283.06 g/mol |
| IUPAC name | 1-bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene |
| InChIKey | KDNLQJIMDWXOHJ-UHFFFAOYSA-N |
| SMILES | C1C(C(C1(F)F)(F)F)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)