CAS 2138073-27-3 is the registry number for rel-Methyl (2R,5R)-5-(aminomethyl)-1-((4-nitrophenyl)sulfonyl)piperidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,5R)-5-(aminomethyl)-1-(4-nitrophenyl)sulfonylpiperidine-2-carboxylate (CAS 2138073-27-3) is a chemical compound with the molecular formula C14H19N3O6S and a molecular weight of 357.38 g/mol. IUPAC name: methyl (2R,5R)-5-(aminomethyl)-1-(4-nitrophenyl)sulfonylpiperidine-2-carboxylate. InChIKey: NYCYVYYIHSYCTA-ZWNOBZJWSA-N.
| Molecular formula | C14H19N3O6S |
|---|---|
| Molecular weight | 357.38 g/mol |
| IUPAC name | methyl (2R,5R)-5-(aminomethyl)-1-(4-nitrophenyl)sulfonylpiperidine-2-carboxylate |
| InChIKey | NYCYVYYIHSYCTA-ZWNOBZJWSA-N |
| SMILES | COC(=O)[C@H]1CC[C@@H](CN1S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-])CN |
Computed by PubChem (NCBI)